CAS 127604-16-4 appears in our catalog under these names: Sodium (s)-3-hydroxybutanoate, 95%, (S)–3–Hydroxybutyrate (sodium salt), (S)-(+)-3-Hydroxybutyric acid sodium salt, 98%, 98%, SODIUM (S)-3-HYDROXYBUTANOATE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 500mg, 100mg, 250mg, 10g, 25g.
Sodium (3S)-3-hydroxybutanoate (CAS 127604-16-4) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 126.09 g/mol. IUPAC name: sodium (3S)-3-hydroxybutanoate. InChIKey: NBPUSGBJDWCHKC-DFWYDOINSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 126.09 g/mol |
| IUPAC name | sodium (3S)-3-hydroxybutanoate |
| InChIKey | NBPUSGBJDWCHKC-DFWYDOINSA-M |
| SMILES | C[C@@H](CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)