CAS 1629168-61-1 is the registry number for Sodium (S)-2-hydroxybutanoate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 100g, 1g.
Sodium (2S)-2-hydroxybutanoate (CAS 1629168-61-1) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 126.09 g/mol. IUPAC name: sodium (2S)-2-hydroxybutanoate. InChIKey: MOSCXNXKSOHVSQ-DFWYDOINSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 126.09 g/mol |
| IUPAC name | sodium (2S)-2-hydroxybutanoate |
| InChIKey | MOSCXNXKSOHVSQ-DFWYDOINSA-M |
| SMILES | CC[C@@H](C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)