cas: 101711-78-8 — see every product listed under this CAS number, including other names
(S)-(+)-4-Benzyl-3-propionyl-2-oxazolidinone, 98% (CAS 101711-78-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036849-5G |
| cas | 101711-78-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 529.00 Pln | |
| Fluorochem | 500g | 2392.93 Pln | |
| Fluorochem | 1kg | 4069.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-benzyl-3-propanoyl-1,3-oxazolidin-2-one (CAS 101711-78-8) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (4S)-4-benzyl-3-propanoyl-1,3-oxazolidin-2-one. InChIKey: WHOBYFHKONUTMW-NSHDSACASA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (4S)-4-benzyl-3-propanoyl-1,3-oxazolidin-2-one |
| InChIKey | WHOBYFHKONUTMW-NSHDSACASA-N |
| SMILES | CCC(=O)N1[C@H](COC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)