cas: 101711-78-8 — see every product listed under this CAS number, including other names
(S)-4-Benzyl-3-propionyloxazolidin-2-one, 97%, 97% (CAS 101711-78-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11438D-250mg |
| cas | 101711-78-8 |
| size | 250mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 434.00 Pln | |
| Chemat | 250g | 995.60 Pln | |
| Chemat | 500g | 2001.60 Pln | |
| Chemat | 1kg | 3602.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-benzyl-3-propanoyl-1,3-oxazolidin-2-one (CAS 101711-78-8) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (4S)-4-benzyl-3-propanoyl-1,3-oxazolidin-2-one. InChIKey: WHOBYFHKONUTMW-NSHDSACASA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (4S)-4-benzyl-3-propanoyl-1,3-oxazolidin-2-one |
| InChIKey | WHOBYFHKONUTMW-NSHDSACASA-N |
| SMILES | CCC(=O)N1[C@H](COC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)