cas: 1374636-08-4 — see every product listed under this CAS number, including other names
(S)-(2-Amino-3,3-dimethylbutyl)carbamic acid tert-butyl ester, 95%, 95% (CAS 1374636-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110JZG-1g |
| cas | 1374636-08-4 |
| size | 1g |
| availability | 17g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1667.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-2-amino-3,3-dimethylbutyl]carbamate (CAS 1374636-08-4) is a chemical compound with the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. IUPAC name: tert-butyl N-[(2S)-2-amino-3,3-dimethylbutyl]carbamate. InChIKey: OTSWUUVDIYKZTD-MRVPVSSYSA-N.
| Molecular formula | C11H24N2O2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-amino-3,3-dimethylbutyl]carbamate |
| InChIKey | OTSWUUVDIYKZTD-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@@H](CNC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)