CAS 1374636-08-4 appears in our catalog under these names: (S)-(2-Amino-3,3-dimethyl-butyl)-carbamic acid tert-butyl ester, 97%, (S)-tert-Butyl (2-amino-3,3-dimethylbutyl)carbamate, 95%, (S)-(2-Amino-3,3-dimethylbutyl)carbamic acid tert-butyl ester, 95%, 95%, tert-Butyl (S)-(2-amino-3,3-dimethylbutyl)carbamate, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
Tert-butyl N-[(2S)-2-amino-3,3-dimethylbutyl]carbamate (CAS 1374636-08-4) is a chemical compound with the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. IUPAC name: tert-butyl N-[(2S)-2-amino-3,3-dimethylbutyl]carbamate. InChIKey: OTSWUUVDIYKZTD-MRVPVSSYSA-N.
| Molecular formula | C11H24N2O2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-amino-3,3-dimethylbutyl]carbamate |
| InChIKey | OTSWUUVDIYKZTD-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@@H](CNC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)