CAS 958281-81-7 is the registry number for (R)-tert-Butyl 1-amino-3,3-dimethylbutan-2-ylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(2R)-1-amino-3,3-dimethylbutan-2-yl]carbamate (CAS 958281-81-7) is a chemical compound with the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. IUPAC name: tert-butyl N-[(2R)-1-amino-3,3-dimethylbutan-2-yl]carbamate. InChIKey: PZCDWEOQKBSMMC-QMMMGPOBSA-N.
| Molecular formula | C11H24N2O2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-amino-3,3-dimethylbutan-2-yl]carbamate |
| InChIKey | PZCDWEOQKBSMMC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[C@H](CN)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)