(S)-1-(2-Bromopyridin-4-yl)ethanamine dihydrochloride, 97%
cas: 1391563-33-9 — see every product listed under this CAS number, including other names
(S)-1-(2-Bromopyridin-4-yl)ethanamine dihydrochloride, 97% (CAS 1391563-33-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A229978-50mg |
| cas | 1391563-33-9 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 448.25 Pln | |
| Ambeed | 100mg | 715.25 Pln | |
| Ambeed | 250mg | 1171.38 Pln | |
| Chemat | 50mg | 462.80 Pln | |
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1216.40 Pln | |
| Chemat | 1g | 3179.60 Pln | |
| BLDpharm | 50mg | 480.97 Pln | |
| BLDpharm | 100mg | 764.20 Pln | |
| BLDpharm | 250mg | 1258.47 Pln | |
| BLDpharm | 1g | 3263.32 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-1-(2-bromo-4-pyridinyl)ethanamine;dihydrochloride (CAS 1391563-33-9) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: (1S)-1-(2-bromo-4-pyridinyl)ethanamine;dihydrochloride. InChIKey: UFFPOOKKWWDFDY-XRIGFGBMSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | (1S)-1-(2-bromo-4-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | UFFPOOKKWWDFDY-XRIGFGBMSA-N |
| SMILES | C[C@@H](C1=CC(=NC=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-1-(2-Bromopyridin-4-yl)ethanamine dihydrochloride, (S)-2-bromo-4-(1-amino)ethylpyridine dihydrochloride, (S)-1-(2-bromopyridin-4-yl)ethan-1-amine dihydrochloride, (1S)-1-(2-Bromo(4-pyridyl))ethylamine diHCl, (1S)-1-(2-bromo-4-pyridyl)ethanamine;dihydrochloride, (1S)-1-(2-bromopyridin-4-yl)ethanamine;dihydrochloride