CAS 1391563-33-9 appears in our catalog under these names: (S)-1-(2-Bromopyridin-4-yl)ethanamine dihydrochloride, 97%, 97%, (S)-1-(2-Bromopyridin-4-yl)ethanamine dihydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(1S)-1-(2-bromo-4-pyridinyl)ethanamine;dihydrochloride (CAS 1391563-33-9) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: (1S)-1-(2-bromo-4-pyridinyl)ethanamine;dihydrochloride. InChIKey: UFFPOOKKWWDFDY-XRIGFGBMSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | (1S)-1-(2-bromo-4-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | UFFPOOKKWWDFDY-XRIGFGBMSA-N |
| SMILES | C[C@@H](C1=CC(=NC=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)