CAS 2411592-08-8 appears in our catalog under these names: (1R)-1-(5-Bromo(3-pyridyl))ethylamine dihydrochloride, 95%, (R)–1–(5–Bromopyridin–3–yl)ethanamine dihydrochloride, (R)-1-(5-Bromopyridin-3-yl)ethanamine dihydrochloride, 95%, 95%, (R)-1-(5-Bromopyridin-3-yl)ethanamine dihydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(5-bromo-3-pyridinyl)ethanamine;dihydrochloride (CAS 2411592-08-8) is a chemical compound with the molecular formula C7H11BrCl2N2 and a molecular weight of 273.98 g/mol. IUPAC name: (1R)-1-(5-bromo-3-pyridinyl)ethanamine;dihydrochloride. InChIKey: ORFXWWIUGLXZTI-ZJIMSODOSA-N.
| Molecular formula | C7H11BrCl2N2 |
|---|---|
| Molecular weight | 273.98 g/mol |
| IUPAC name | (1R)-1-(5-bromo-3-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | ORFXWWIUGLXZTI-ZJIMSODOSA-N |
| SMILES | C[C@H](C1=CC(=CN=C1)Br)N.Cl.Cl |
Computed by PubChem (NCBI)