cas: 127733-40-8 — see every product listed under this CAS number, including other names
(S)-1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine 97% (CAS 127733-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110217-100mg |
| cas | 127733-40-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1377.19 Pln | |
| Ambeed | 5g | 5332.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A110217 |
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine (CAS 127733-40-8) is a chemical compound with the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. IUPAC name: (1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine. InChIKey: PFVWEAYXWZFSSK-YFKPBYRVSA-N.
| Molecular formula | C10H9F6N |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine |
| InChIKey | PFVWEAYXWZFSSK-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)