CAS 1213931-86-2 is the registry number for (S)-2,2,2-Trifluoro-1-(2-methyl-3-(trifluoromethyl)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2,2-trifluoro-1-[2-methyl-3-(trifluoromethyl)phenyl]ethanamine (CAS 1213931-86-2) is a chemical compound with the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-[2-methyl-3-(trifluoromethyl)phenyl]ethanamine. InChIKey: BDCNDXJOPXYEJL-QMMMGPOBSA-N.
| Molecular formula | C10H9F6N |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-[2-methyl-3-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | BDCNDXJOPXYEJL-QMMMGPOBSA-N |
| SMILES | CC1=C(C=CC=C1C(F)(F)F)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)