CAS 49850-16-0 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)-n-ethylaniline, 95%, 3,5-Bis(trifluoromethyl)-N-ethylaniline. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g.
N-ethyl-3,5-bis(trifluoromethyl)aniline (CAS 49850-16-0) is a chemical compound with the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. IUPAC name: N-ethyl-3,5-bis(trifluoromethyl)aniline. InChIKey: WOIXGFNIYODSEA-UHFFFAOYSA-N.
| Molecular formula | C10H9F6N |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | N-ethyl-3,5-bis(trifluoromethyl)aniline |
| InChIKey | WOIXGFNIYODSEA-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)