cas: 127852-21-5 — see every product listed under this CAS number, including other names
(S)-1-(3-(Trifluoromethyl)phenyl)ethanamine 95% (CAS 127852-21-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A534841-5g |
| cas | 127852-21-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 6500.25 Pln | |
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A534841 |
(1S)-1-[3-(trifluoromethyl)phenyl]ethanamine (CAS 127852-21-5) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: (1S)-1-[3-(trifluoromethyl)phenyl]ethanamine. InChIKey: ODZXRBRYQGYVJY-LURJTMIESA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | (1S)-1-[3-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | ODZXRBRYQGYVJY-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)