cas: 84499-77-4 — see every product listed under this CAS number, including other names
(S)-1-(4-Bromophenyl)ethanamine hydrochloride, 97% (CAS 84499-77-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F325161-1G |
| cas | 84499-77-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 820.56 Pln | |
| Fluorochem | 100g | 3007.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 84499-77-4) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)