cas: 40154-78-7 — see every product listed under this CAS number, including other names
(S)-1-(Pyridin-2-yl)ethanamine dihydrochloride, 95%, 95% (CAS 40154-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CIUU-100mg |
| cas | 40154-78-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1653.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-pyridin-2-ylethanamine;dihydrochloride (CAS 40154-78-7) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1S)-1-pyridin-2-ylethanamine;dihydrochloride. InChIKey: JNBVPGDYRRBINU-ILKKLZGPSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1S)-1-pyridin-2-ylethanamine;dihydrochloride |
| InChIKey | JNBVPGDYRRBINU-ILKKLZGPSA-N |
| SMILES | C[C@@H](C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)