CAS 1352640-52-8 appears in our catalog under these names: (R)-1-(Pyridin-2-yl)ethanamine dihydrochloride, 95%, (R)–1–(Pyridin–2–yl)ethanamine dihydrochloride, (R)-1-(Pyridin-2-yl)ethanamine dihydrochloride, (R)-1-(Pyridin-2-yl)ethanamine dihydrochloride, 97%, 97%, (R)-1-(Pyridin-2-yl)ethanamine dihydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(1R)-1-pyridin-2-ylethanamine;dihydrochloride (CAS 1352640-52-8) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1R)-1-pyridin-2-ylethanamine;dihydrochloride. InChIKey: JNBVPGDYRRBINU-QYCVXMPOSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1R)-1-pyridin-2-ylethanamine;dihydrochloride |
| InChIKey | JNBVPGDYRRBINU-QYCVXMPOSA-N |
| SMILES | C[C@H](C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)