cas: 159532-59-9 — see every product listed under this CAS number, including other names
(S)-1-(tert-Butoxycarbonyl)piperazine-2-carboxylic acid 97% (CAS 159532-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210960-250mg |
| cas | 159532-59-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 25g | 2534.19 Pln | |
| Ambeed | 100g | 6094.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210960 |
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 159532-59-9) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: MPOFEHGMWPHBSF-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | MPOFEHGMWPHBSF-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@H]1C(=O)O |
Computed by PubChem (NCBI)