CAS 848482-93-9 appears in our catalog under these names: (S)-4-Boc-Piperazine-2-carboxylic acid, 97%, (S)-4-(tert-Butoxycarbonyl)piperazine-2-carboxylic acid 97%, (S)-1-N-Boc-piperazine-3-carboxylic acid, 98%, 98%, (S)-4-N-Boc-Piperazine-2-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 500g, 250mg, 100g, 50g.
(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 848482-93-9) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: YRYAXQJXMBETAT-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | YRYAXQJXMBETAT-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)