CAS 1782647-31-7 appears in our catalog under these names: 1,3-Azetidinedicarboxylic acid, 3-amino-, 1-(1,1-dimethylethyl) 3-methyl ester, 95%, 1–(tert–Butyl) 3–methyl 3–aminoazetidine–1,3–dicarboxylate, 1-tert-Butyl 3-methyl 3-aminoazetidine-1,3-dicarboxylate 97%, 1-tert-Butyl 3-methyl 3-aminoazetidine-1,3-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
1-O-tert-butyl 3-O-methyl 3-aminoazetidine-1,3-dicarboxylate (CAS 1782647-31-7) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-aminoazetidine-1,3-dicarboxylate. InChIKey: BINCCFKDJYPIFA-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-aminoazetidine-1,3-dicarboxylate |
| InChIKey | BINCCFKDJYPIFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)OC)N |
Computed by PubChem (NCBI)