cas: 40291-26-7 — see every product listed under this CAS number, including other names
(S)-1-Benzyl 2-(2,5-dioxopyrrolidin-1-yl) 5-oxopyrrolidine-1,2-dicarboxylate (CAS 40291-26-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219733-1G |
| cas | 40291-26-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 100g | 2918.78 Pln |
| delivery time | 2-3 weeks |
|---|
1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 40291-26-7) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: 1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: LZNYDJDSWANAND-LBPRGKRZSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | LZNYDJDSWANAND-LBPRGKRZSA-N |
| SMILES | C1CC(=O)N([C@@H]1C(=O)ON2C(=O)CCC2=O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)