cas: 40291-26-7 — see every product listed under this CAS number, including other names
Z-Pyr-OSu 98% (CAS 40291-26-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139017-500g |
| cas | 40291-26-7 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 7635.00 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 576.19 Pln | |
| Ambeed | 100g | 1961.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139017 |
1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 40291-26-7) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: 1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: LZNYDJDSWANAND-LBPRGKRZSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 1-O-benzyl 2-O-(2,5-dioxopyrrolidin-1-yl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | LZNYDJDSWANAND-LBPRGKRZSA-N |
| SMILES | C1CC(=O)N([C@@H]1C(=O)ON2C(=O)CCC2=O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)