CAS 1676-91-1 is the registry number for 4-Nitrophenyl n-[(benzyloxy)carbonyl]-l-serinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-nitrophenyl) (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate (CAS 1676-91-1) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: (4-nitrophenyl) (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: WSSWIPRIDMKWQY-HNNXBMFYSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | WSSWIPRIDMKWQY-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CO)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)