cas: 178172-26-4 — see every product listed under this CAS number, including other names
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester, 95% GC, 95% GC (CAS 178172-26-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136T7-100mg |
| cas | 178172-26-4 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 400.40 Pln |
| purity | 95% GC |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate (CAS 178172-26-4) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate. InChIKey: AZVLZXHTXUIWRZ-VIFPVBQESA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | AZVLZXHTXUIWRZ-VIFPVBQESA-N |
| SMILES | CCOC(=O)[C@@H]1CC=CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)