CAS 178172-26-4 appears in our catalog under these names: (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester, 97%, (S)–1–Boc–2,3–dihydro–2–pyrrolecarboxylic Acid, (S)-1-tert-Butyl 2-ethyl 2,3-dihydro-1H-pyrrole-1,2-dicarboxylate 95% GC, (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester, 95% GC, 95% GC. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate (CAS 178172-26-4) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate. InChIKey: AZVLZXHTXUIWRZ-VIFPVBQESA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate |
| InChIKey | AZVLZXHTXUIWRZ-VIFPVBQESA-N |
| SMILES | CCOC(=O)[C@@H]1CC=CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)