cas: 479253-00-4 — see every product listed under this CAS number, including other names
(S)-1-Boc-3-Fluoropyrrolidine, 98% (CAS 479253-00-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216894-250MG |
| cas | 479253-00-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1226.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-fluoropyrrolidine-1-carboxylate (CAS 479253-00-4) is a chemical compound with the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. IUPAC name: tert-butyl (3S)-3-fluoropyrrolidine-1-carboxylate. InChIKey: SUECTKVSIDXQQE-ZETCQYMHSA-N.
| Molecular formula | C9H16FNO2 |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | tert-butyl (3S)-3-fluoropyrrolidine-1-carboxylate |
| InChIKey | SUECTKVSIDXQQE-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)F |
Computed by PubChem (NCBI)