CAS 2031242-75-6 is the registry number for tert-Butyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate (CAS 2031242-75-6) is a chemical compound with the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. IUPAC name: tert-butyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate. InChIKey: JMORIDAQGDQESW-RNFRBKRXSA-N.
| Molecular formula | C9H16FNO2 |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | tert-butyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate |
| InChIKey | JMORIDAQGDQESW-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@H](CN1)F |
Computed by PubChem (NCBI)