CAS 876617-25-3 appears in our catalog under these names: (R)–1–Boc–3–fluoropyrrolidine, (R)-1-Boc-3-fluoropyrrolidine, 95%, (R)-1-Boc-3-Fluoropyrrolidine 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Tert-butyl (3R)-3-fluoropyrrolidine-1-carboxylate (CAS 876617-25-3) is a chemical compound with the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. IUPAC name: tert-butyl (3R)-3-fluoropyrrolidine-1-carboxylate. InChIKey: SUECTKVSIDXQQE-SSDOTTSWSA-N.
| Molecular formula | C9H16FNO2 |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | tert-butyl (3R)-3-fluoropyrrolidine-1-carboxylate |
| InChIKey | SUECTKVSIDXQQE-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)F |
Computed by PubChem (NCBI)