cas: 1353006-46-8 — see every product listed under this CAS number, including other names
(S)-1-Boc-3-Methylpiperazine hydrochloride, 98% (CAS 1353006-46-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633592-25G |
| cas | 1353006-46-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 409.25 Pln | |
| Fluorochem | 100g | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride (CAS 1353006-46-8) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: SYNMIMWDYFYCCC-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | SYNMIMWDYFYCCC-QRPNPIFTSA-N |
| SMILES | C[C@H]1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)