cas: 75703-08-1 — see every product listed under this CAS number, including other names
(S)-1-Cyclohexyl-2,2,2-trifluoro-ethylamine (CAS 75703-08-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044291-250MG |
| cas | 75703-08-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 2236.73 Pln | |
| Fluorochem | 5g | 7547.36 Pln |
| delivery time | 2-3 weeks |
|---|
(1S)-1-cyclohexyl-2,2,2-trifluoroethanamine (CAS 75703-08-1) is a chemical compound with the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. IUPAC name: (1S)-1-cyclohexyl-2,2,2-trifluoroethanamine. InChIKey: HTJYTQSIEXSPGU-ZETCQYMHSA-N.
| Molecular formula | C8H14F3N |
|---|---|
| Molecular weight | 181.20 g/mol |
| IUPAC name | (1S)-1-cyclohexyl-2,2,2-trifluoroethanamine |
| InChIKey | HTJYTQSIEXSPGU-ZETCQYMHSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)