cas: 242459-44-5 — see every product listed under this CAS number, including other names
(S)-1-N-Boc-2-Cyano-piperidine, 97% (CAS 242459-44-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034518-100MG |
| cas | 242459-44-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 2502.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S)-2-cyanopiperidine-1-carboxylate (CAS 242459-44-5) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl (2S)-2-cyanopiperidine-1-carboxylate. InChIKey: LKAJZBMOVZIKHA-VIFPVBQESA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl (2S)-2-cyanopiperidine-1-carboxylate |
| InChIKey | LKAJZBMOVZIKHA-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C#N |
Computed by PubChem (NCBI)