CAS 129170-43-0 appears in our catalog under these names: (1S,2S)-1-(4-Aminophenyl)-2-(dimethylamino)propane-1,3-diol, 95%, L-(+)-Threo-2-(N,N-dimethylamino)-1-(4-aminophenyl)-1,3-propanediol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg.
(1S,2S)-1-(4-aminophenyl)-2-(dimethylamino)propane-1,3-diol (CAS 129170-43-0) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: (1S,2S)-1-(4-aminophenyl)-2-(dimethylamino)propane-1,3-diol. InChIKey: QYGLNAUVXLNBNS-QWRGUYRKSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (1S,2S)-1-(4-aminophenyl)-2-(dimethylamino)propane-1,3-diol |
| InChIKey | QYGLNAUVXLNBNS-QWRGUYRKSA-N |
| SMILES | CN(C)[C@@H](CO)[C@H](C1=CC=C(C=C1)N)O |
Computed by PubChem (NCBI)