cas: 180854-44-8 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 2-ethyl 4-oxopiperidine-1,2-dicarboxylate, 97% (CAS 180854-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497557-100MG |
| cas | 180854-44-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 500mg | 638.33 Pln | |
| Fluorochem | 1g | 794.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate (CAS 180854-44-8) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate. InChIKey: YAVQLRUBKDCOCI-JTQLQIEISA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-4-oxopiperidine-1,2-dicarboxylate |
| InChIKey | YAVQLRUBKDCOCI-JTQLQIEISA-N |
| SMILES | CCOC(=O)[C@@H]1CC(=O)CCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)