CAS 897043-85-5 appears in our catalog under these names: 1-tert-Butyl 3-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate 97%, 1-tert-butyl 3-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate, 97%, 97%, 1-TERT-BUTYL 3-ETHYL 3-METHYL-4-OXOPYRROLIDINE-1,3-DICARBOXYLATE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g, 500mg, 10g.
1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate (CAS 897043-85-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate. InChIKey: YDASEKAEWNKGEJ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate |
| InChIKey | YDASEKAEWNKGEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(CC1=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)