Products 2380766-95-8
CAS 2380766-95-8 is the registry number for Wuxiapptec wx110681, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(3aR,7aR)-5-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxylic acid (CAS 2380766-95-8) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: (3aR,7aR)-5-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxylic acid. InChIKey: ZPRFJQKYRCYHPF-NOZJJQNGSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | (3aR,7aR)-5-[(2-methylpropan-2-yl)oxycarbonyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxylic acid |
| InChIKey | ZPRFJQKYRCYHPF-NOZJJQNGSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@](C1)(CCO2)C(=O)O |
Computed by PubChem (NCBI)