cas: 929804-89-7 — see every product listed under this CAS number, including other names
(S)-2,2,2-Trifluoro-1-(4-fluorophenyl)ethylamine, 98%, 98% (CAS 929804-89-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRLZ-100mg |
| cas | 929804-89-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1854.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine (CAS 929804-89-7) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine. InChIKey: FRDAKAYQSQLWRW-ZETCQYMHSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine |
| InChIKey | FRDAKAYQSQLWRW-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)F |
Computed by PubChem (NCBI)