CAS 1511180-15-6 is the registry number for 4-Fluoro-3-methyl-2-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
4-fluoro-3-methyl-2-(trifluoromethyl)aniline (CAS 1511180-15-6) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: 4-fluoro-3-methyl-2-(trifluoromethyl)aniline. InChIKey: NZGWXSMGRPJDDP-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | 4-fluoro-3-methyl-2-(trifluoromethyl)aniline |
| InChIKey | NZGWXSMGRPJDDP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(F)(F)F)N)F |
Computed by PubChem (NCBI)