Products 1373920-66-1
CAS 1373920-66-1 is the registry number for 2-Fluoro-5-methyl-4-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-5-methyl-4-(trifluoromethyl)aniline (CAS 1373920-66-1) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: 2-fluoro-5-methyl-4-(trifluoromethyl)aniline. InChIKey: SCCCZPNCTRGYDF-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | 2-fluoro-5-methyl-4-(trifluoromethyl)aniline |
| InChIKey | SCCCZPNCTRGYDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(F)(F)F)F)N |
Computed by PubChem (NCBI)