cas: 180675-08-5 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-((3-methylpentan-3-yl)oxy)-4-oxobutanoic acid, 98%, 98% (CAS 180675-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11338V-100mg |
| cas | 180675-08-5 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Chemat | 100g | 2680.40 Pln | |
| Chemat | 250g | 3966.80 Pln | |
| Chemat | 500g | 7027.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid (CAS 180675-08-5) is a chemical compound with the molecular formula C25H29NO6 and a molecular weight of 439.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid. InChIKey: SYGKUYKLHYQKPL-NRFANRHFSA-N.
| Molecular formula | C25H29NO6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid |
| InChIKey | SYGKUYKLHYQKPL-NRFANRHFSA-N |
| SMILES | CCC(C)(CC)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)