CAS 1429504-34-6 appears in our catalog under these names: Daptomycin Impurity 30, Fmoc-3-Me-Glu(OtBu)-OH. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 1429504-34-6) is a chemical compound with the molecular formula C25H29NO6 and a molecular weight of 439.5 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: HYWKADVVVLDYEH-QRQCRPRQSA-N.
| Molecular formula | C25H29NO6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | HYWKADVVVLDYEH-QRQCRPRQSA-N |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)