CAS 180675-08-5 appears in our catalog under these names: Fmoc–Asp(OMpe)–OH, Fmoc-L-Asp(OMpe)-OH, N-Fmoc-L-aspartic acid 4-methylpentyl ester, 98% , Fmoc-L-aspartic acid β-methylpentyl ester, Fmoc-Asp(OMpe)-OH 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 5g, 1g, 25g, 0,025kg, 0,05kg, 0,1kg, 0,25kg, 500g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid (CAS 180675-08-5) is a chemical compound with the molecular formula C25H29NO6 and a molecular weight of 439.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid. InChIKey: SYGKUYKLHYQKPL-NRFANRHFSA-N.
| Molecular formula | C25H29NO6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylpentan-3-yloxy)-4-oxobutanoic acid |
| InChIKey | SYGKUYKLHYQKPL-NRFANRHFSA-N |
| SMILES | CCC(C)(CC)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)