cas: 374899-60-2 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-hydroxyhexanoic acid, 96%, 96% (CAS 374899-60-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8ZZ-100mg |
| cas | 374899-60-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1806.80 Pln | |
| Chemat | 5g | 6170.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid (CAS 374899-60-2) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid. InChIKey: RLKMUBZYLZBKMO-IBGZPJMESA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid |
| InChIKey | RLKMUBZYLZBKMO-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCO)C(=O)O |
Computed by PubChem (NCBI)