CAS 117666-94-1 appears in our catalog under these names: Boc–p–Bz–D–Phe–OH, Boc-d-bpa-oh, 95%, Boc-D-Bpa-OH. Offered by: GLPBio, Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 250mg, 5g, 25g.
(2R)-3-(4-benzoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 117666-94-1) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (2R)-3-(4-benzoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: HIQJNYPOWPXYIC-QGZVFWFLSA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2R)-3-(4-benzoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | HIQJNYPOWPXYIC-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)