CAS 374899-60-2 appears in our catalog under these names: Fmoc-l-nle(6-oh)-oh, 98%, (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–6–hydroxyhexanoic acid, Fmoc-L-Nle(6-OH)-OH, Fmoc-L-Nle(6-OH)-OH 96%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-hydroxyhexanoic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg, 25g, 500mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid (CAS 374899-60-2) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid. InChIKey: RLKMUBZYLZBKMO-IBGZPJMESA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid |
| InChIKey | RLKMUBZYLZBKMO-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCO)C(=O)O |
Computed by PubChem (NCBI)