cas: 959583-60-9 — see every product listed under this CAS number, including other names
(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-carbamoylphenyl)propanoic acid, 98% (CAS 959583-60-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F754127-250MG |
| cas | 959583-60-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1200.64 Pln | |
| Fluorochem | 1g | 2892.75 Pln | |
| Fluorochem | 5g | 10921.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-3-(2-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 959583-60-9) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2S)-3-(2-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: JHXIDHXZDZFPNT-QFIPXVFZSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2S)-3-(2-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | JHXIDHXZDZFPNT-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)N |
Computed by PubChem (NCBI)