Products 959583-60-9
CAS 959583-60-9 appears in our catalog under these names: Fmoc-l-2-carbamoylphenylalanine, 95%, Fmoc–L–2–carbamoylphenylalanine, Fmoc-L-2-Carbamoylphe 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2S)-3-(2-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 959583-60-9) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2S)-3-(2-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: JHXIDHXZDZFPNT-QFIPXVFZSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2S)-3-(2-carbamoylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | JHXIDHXZDZFPNT-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)N |
Computed by PubChem (NCBI)