CAS 1384870-47-6 appears in our catalog under these names: DBCO NHS ester, 95%, DBCO-C6-NHS ester, 98%, DBCO-C6-NHS Ester, DBCO-NHS ester 2, DBCO-NHS. Offered by: Lumiprobe, Combi-blocks, TRC, TargetMol, Iris Biotech. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1g, 5g, 250mg, 2mg.
(2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate (CAS 1384870-47-6) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate. InChIKey: CATTUKBAYDNTEG-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate |
| InChIKey | CATTUKBAYDNTEG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)