cas: 3918-87-4 — see every product listed under this CAS number, including other names
(S)-2-((S)-2-Amino-3-phenylpropanamido)propanoic acid, 97%, 97% (CAS 3918-87-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8QC-100mg |
| cas | 3918-87-4 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 458.00 Pln | |
| Chemat | 25g | 678.80 Pln | |
| Chemat | 100g | 2522.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Phe-Ala is a dipeptide formed from L-phenylalanine and L-alanine residues. It has a role as a metabolite. It is functionally related to a L-alanine and a L-phenylalanine. It is a tautomer of a Phe-Ala zwitterion.
Source: ChEBI
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoic acid |
| InChIKey | MIDZLCFIAINOQN-WPRPVWTQSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)