CAS 1235666-16-6 appears in our catalog under these names: 2-(2,2-Dimethyl-propionylamino)-isonicotinic acid methyl ester, 95%, Methyl 2-pivalamidoisonicotinate 95+%, Methyl 2-pivalamidoisonicotinate, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
Methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate (CAS 1235666-16-6) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate. InChIKey: VIINVAGIQKVNOV-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate |
| InChIKey | VIINVAGIQKVNOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)C(=O)OC |
Computed by PubChem (NCBI)