Products 3061-95-8
CAS 3061-95-8 appears in our catalog under these names: H-D-Ala-phe-oh, 95%, H-D-Ala-phe-oh, >95% (HPLC), H–D–Ala–Phe–OH, D-Alanyl-L-phenylalanine, H-D-Ala-Phe-OH, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 500mg, 1 g, 250 mg, 500 mg.
(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoic acid (CAS 3061-95-8) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: (2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoic acid. InChIKey: OMNVYXHOSHNURL-SCZZXKLOSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | OMNVYXHOSHNURL-SCZZXKLOSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N |
Computed by PubChem (NCBI)